Feedback

3,7,11,15-tetramethylhexadecanoate

MNXM91275 is deprecated and here replaced by MNXM731141
!!! Alternative mappings exist !!!
PropertiesImageOccurences in reactions
MNX_IDMNXM731141Image of MNXM731141
#reac
in my sandbox 0
in MNXref (generic)8
in models (compartimentalized) 10
formulaC20H39O2
charge-1
mass311.29555
referencechebi:37257
InChIKeyRLCKHJSFHOZMDR-UHFFFAOYSA-M
InChIInChI=1S/C20H40O2/c1-16(2)9-6-10-17(3)11-7-12-18(4)13-8-14-19(5)15-20(21)22/h16-19H,6-15H2,1-5H3,(H,21,22)/p-1
SMILESCC(C)CCCC(C)CCCC(C)CCCC(C)CC(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:37257
chebi:37257
3,7,11,15-tetramethylhexadecanoate
3,7,11,15-tetramethylpalmitate
phytanate
phytanate anion
bigg.metabolite:CE2414
biggM:CE2414
(3S,7R,11R)-phytanate
seed.compound:cpd01130
seedM:cpd01130
Phytanate
3,7,11,15-Tetramethylhexadecanoic acid
3,7,11,15-tetramethylhexadecanoate
3,7,11,15-tetramethylpalmitate
Phytanic acid
phytanate
phytanic acid
kegg.compound:C01607
keggC:C01607
Phytanate
3,7,11,15-Tetramethylhexadecanoic acid
Phytanic acid
sabiork.compound:5693
sabiorkM:5693
Phytanate
Phytanic acid
bigg.metabolite:phyt
biggM:phyt
Phytanic acid
hmdb:HMDB0000801 Phytanic acid
3,7,11,15-Tetramethyl hexadecanoate
3,7,11,15-Tetramethyl hexadecanoic acid
3,7,11,15-Tetramethyl-hexadecanoate
3,7,11,15-Tetramethyl-hexadecanoic acid
3,7,11,15-Tetramethyl-hexadecansaeure
3,7,11,15-Tetramethylhexadecanoate
3,7,11,15-Tetramethylhexadecanoic acid
3,7,11,15-Tetramethylhexadecoanoate
3,7,11,15-Tetramethylhexadecoanoic acid
3,7,11,15-tetramethylhexadecanoic acid
Acid, phytanic
Phytanate
Phytanoate
Phytanoic acid
phytanic acid
metacyc.compound:PHYTANATE
metacycM:PHYTANATE
phytanate
3,7,11,15-tetramethylhexadecanoate
3,7,11,15-tetramethylpalmitate
phytanic acid
reactome:R-ALL-389596
reactomeM:R-ALL-389596
CHEBI:16285
chebi:16285
phytanic acid
3,7,11,15-Tetramethyl-hexadecansaeure
3,7,11,15-tetramethyl hexadecanoic acid
3,7,11,15-tetramethyl-hexadecanoic acid
3,7,11,15-tetramethylhexadecanoic acid
Phytanic acid
hmdb:HMDB00801
chebi:14834
chebi:26109
chebi:26111
chebi:8189
biggM:M_CE2414
biggM:M_phyt
keggC:M_C01607
seedM:M_cpd01130
secondary/obsolete/fantasy identifier