Feedback

6-amino-2-oxohexanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM916Image of MNXM916
#reac
in my sandbox 0
in MNXref (generic)17
in models (compartimentalized) 7
formulaC6H11NO3
charge0
mass145.15648
referencechebi:58183
InChIKeyGWENQMVPLJAMAE-UHFFFAOYSA-N
InChIInChI=1S/C6H11NO3/c7-4-2-1-3-5(8)6(9)10/h1-4,7H2,(H,9,10)
SMILES[NH3+]CCCCC(=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58183
chebi:58183
6-amino-2-oxohexanoate
6-amino-2-oxohexanoic acid zwitterion
6-ammonio-2-oxohexanoate
6-azaniumyl-2-oxohexanoate
hmdb:HMDB0012151 2-Keto-6-aminocaproate
2-keto-6-Aminocaproic acid
2-keto-6-amino-Caproate
2-keto-6-amino-Caproic acid
2-oxo-6-Aminocaproate
2-oxo-6-Aminocaproic acid
2-oxo-6-Aminohexanoate
2-oxo-6-Aminohexanoic acid
6-amino-2-Oxohexanoate
6-amino-2-Oxohexanoic acid
6-amino-2-oxohexanoic acid
alpha-Ketolysine
alpha-keto-epsilon-Aminocaproate
alpha-keto-epsilon-Aminocaproic acid
alpha-keto-epsilon-Aminohexanoate
alpha-keto-epsilon-Aminohexanoic acid
seed.compound:cpd02074
seedM:cpd02074
2-Oxo-6-aminocaproate
2-keto-6-aminocaproate
2-oxo-6-aminocaproate
2-oxo-6-aminohexanoate
6-Amino-2-oxohexanoate
6-amino-2-oxohexanoate
6a2ohxnt
alpha-keto-epsilon-aminocaproate
alpha-keto-epsilon-aminohexanoate
alpha-ketolysine
bigg.metabolite:6a2ohxnt
biggM:6a2ohxnt
6-Amino-2-oxohexanoate
kegg.compound:C03239
keggC:C03239
6-Amino-2-oxohexanoate
2-Oxo-6-aminocaproate
sabiork.compound:6500
sabiorkM:6500
6-Amino-2-oxohexanoate
2-Oxo-6-aminocaproate
6-Amino-2-oxohexanoic acid
metacyc.compound:2-KETO-6-AMINO-CAPROATE
metacycM:2-KETO-6-AMINO-CAPROATE
6-amino-2-oxohexanoate
2-keto-6-aminocaproate
2-oxo-6-aminocaproate
alpha-keto-epsilon-aminocaproate
alpha-keto-epsilon-aminohexanoate
alpha-ketolysine
CHEBI:17534
chebi:17534
6-amino-2-oxohexanoic acid
2-Oxo-6-aminocaproate
2-oxo-6-aminocaproate
6-Amino-2-oxohexanoate
hmdb:HMDB12151
chebi:12205
chebi:20701
chebi:2170
biggM:M_6a2ohxnt
keggC:M_C03239
seedM:M_cpd02074
secondary/obsolete/fantasy identifier