Feedback

cis-homoaconitate

PropertiesImageOccurences in reactions
MNX_IDMNXM920Image of MNXM920
#reac
in my sandbox 0
in MNXref (generic)5
in models (compartimentalized) 6
formulaC7H5O6
charge-3
mass185.111
referencechebi:58174
InChIKeyBJYPZFUWWJSAKC-ARJAWSKDSA-K
InChIInChI=1S/C7H8O6/c8-5(9)2-1-4(7(12)13)3-6(10)11/h3H,1-2H2,(H,8,9)(H,10,11)(H,12,13)/p-3/b4-3-
SMILES[O-]C(=O)CC\C(=C\C([O-])=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58174
chebi:58174
cis-homoaconitate
(1Z)-but-1-ene-1,2,4-tricarboxylate
but-1-ene-1,2,4-tricarboxylate
but-1-ene-1,2,4-tricarboxylate trianion
cis-homoaconitate trianion
cis-homoaconitate(3-)
hmdb:HMDB0060320 (Z)-But-1-ene-1,2,4-tricarboxylate
(1Z)-but-1-ene-1,2,4-tricarboxylic acid
(Z)-1,2,4-But-1-enetricarboxylate
(Z)-1,2,4-But-1-enetricarboxylic acid
(Z)-But-1-ene-1,2,4-tricarboxylic acid
But-1-ene-1,2,4-tricarboxylate
But-1-ene-1,2,4-tricarboxylic acid
cis-Homoaconitate
cis-Homoaconitic acid
homo-cis-Aconitate
homo-cis-Aconitic acid
homo-cis-aconitate
kegg.compound:C04002
keggC:C04002
(Z)-But-1-ene-1,2,4-tricarboxylate
(Z)-1,2,4-But-1-enetricarboxylic acid
Homo-cis-aconitate
cis-Homoaconitate
seed.compound:cpd28715
seedM:cpd28715
3-carboxyhex-2-enedioate
But-1-ene-1,2,4-tricarboxylate
bigg.metabolite:b124tc
biggM:b124tc
But 1 ene 1 2 4 tricarboxylate
sabiork.compound:7009
sabiorkM:7009
But-1-ene-1,2,4-tricarboxylate
Homo-cis-aconitate
cis-Homoaconitate
bigg.metabolite:hacon_C
biggM:hacon_C
Cis-homoaconitate
lipidmaps:LMFA01030999
lipidmapsM:LMFA01030999
but-1-ene-1,2,4-tricarboxylic acid
(1Z)-but-1-ene-1,2,4-tricarboxylic acid
CHEBI:17516
chebi:17516
but-1-ene-1,2,4-tricarboxylic acid
(1Z)-but-1-ene-1,2,4-tricarboxylic acid
(Z)-1,2,4-But-1-enetricarboxylic acid
But-1-ene-1,2,4-tricarboxylate
Homo-cis-aconitate
cis-Homoaconitate
seed.compound:cpd02483
seedM:cpd02483
cis-Homoaconitate
(Z)-1,2,4-But-1-enetricarboxylic acid
(Z)-1,2,4-but-1-enetricarboxylic acid
(Z)-But-1-ene-1,2,4-tricarboxylate
(Z)-but-1-ene-1,2,4-tricarboxylate
3-carboxyhex-2-enedioate
Homo-cis-aconitate
b124tc
cis-homoaconitate
homo-cis-aconitate
metacyc.compound:HOMO-CIS-ACONITATE
metacycM:HOMO-CIS-ACONITATE
cis-homoaconitate
(Z)-1,2,4-but-1-enetricarboxylic acid
(Z)-but-1-ene-1,2,4-tricarboxylate
3-carboxyhex-2-enedioate
homo-cis-aconitate
hmdb:HMDB60320
chebi:13920
chebi:22935
chebi:3226
biggM:M_b124tc
biggM:M_hacon_C
keggC:M_C04002
seedM:M_cpd02483
seedM:M_cpd28715
secondary/obsolete/fantasy identifier