Feedback

coenzyme B

Properties
MNX_IDMNXM921
formulaC11H19NO7PS
charge-3
mass340.310861
referencechebi:58596
Image of MNXM921
InChIKeyJBJSVEVEEGOEBZ-SCZZXKLOSA-K
InChIInChI=1S/C11H22NO7PS/c1-8(19-20(16,17)18)10(11(14)15)12-9(13)6-4-2-3-5-7-21/h8,10,21H,2-7H2,1H3,(H,12,13)(H,14,15)(H2,16,17,18)/p-3/t8-,10+/m1/s1
SMILESC[C@@H](OP([O-])([O-])=O)[C@H](NC(=O)CCCCCCS)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref23
Distinct compatimentalized reactions in models8

Similar chemical compounds in external resources
IdentifierDescription
chebi:28890 coenzyme B
(2S,3R)-2-[(7-mercaptoheptanoyl)amino]-3-(phosphonooxy)butanoic acid
(2S,3R)-3-phosphonooxy-2-[(7-sulfanylheptanoyl)amino]butanoic acid
7-mercaptoheptanoyl-O-phospho-L-threonine
7-mercaptoheptanoylthreonine phosphate
7-thioheptanoyl-threonine O-phosphate
Coenzyme B
HTP
MHTP
N-(7-Mercaptoheptanoyl)threonine 3-O-phosphate
N-(7-Mercaptoheptanoyl)threonine O3-phosphate
N-(7-mercaptoheptanoyl)-L-threonine 3-O-phosphate
N-(7-sulfanylheptanoyl)-3-O-phosphono-L-threonine
N-(7-sulfanylheptanoyl)-3-phospho-L-threonine
N-(7-sulfanylheptanoyl)-L-threonine 3-(dihydrogen phosphate)
biggM:M_cob
chebi:12434
chebi:12534
chebi:14009
chebi:21474
chebi:23350
chebi:46031
chebi:7093
keggC:M_C04628
seedM:M_cpd02817
secondary/obsolete/fantasy identifier
seedM:cpd02817 HTP
7-mercaptoheptanoyl threonine phosphate
CoB
Coenzyme B
H-S-CoB
HS-HTP
N-(7-Mercaptoheptanoyl)threonine 3-O-phosphate
N-(7-Mercaptoheptanoyl)threonine O3-phosphate
N-(7-mercaptoheptanoyl)-3-O-phosphono-L-threonine
N-(7-mercaptoheptanoyl)-3-phospho-L-threonine
N-(7-mercaptoheptanoyl)-L-threonine 3-O-phosphate
N-(7-mercaptoheptanoyl)threonine 3-O-phosphate
N-(7-mercaptoheptanoyl)threonine O3-phosphate
N-(7-sulfanylheptanoyl)-3-O-phosphono-L-threonine
N-(7-sulfanylheptanoyl)-3-phospho-L-threonine
N-(7-sulfanylheptanoyl)-L-threonine 3-O-phosphate
cob
coenzyme B
coenzyme b
biggM:cob Coenzyme b
metacycM:CPD-1281 coenzyme B
7-mercaptoheptanoyl threonine phosphate
CoB
H-S-CoB
HS-HTP
N-(7-mercaptoheptanoyl)-3-O-phosphono-L-threonine
N-(7-mercaptoheptanoyl)-3-phospho-L-threonine
N-(7-mercaptoheptanoyl)-L-threonine 3-O-phosphate
N-(7-mercaptoheptanoyl)threonine 3-O-phosphate
N-(7-mercaptoheptanoyl)threonine O3-phosphate
N-(7-sulfanylheptanoyl)-3-O-phosphono-L-threonine
N-(7-sulfanylheptanoyl)-3-phospho-L-threonine
N-(7-sulfanylheptanoyl)-L-threonine 3-O-phosphate
keggC:C04628 Coenzyme B
CoB
HTP
N-(7-Mercaptoheptanoyl)threonine 3-O-phosphate
N-(7-Mercaptoheptanoyl)threonine O3-phosphate
chebi:58596 coenzyme B
(2S,3R)-3-(phosphonatooxy)-2-[(7-sulfanylheptanoyl)amino]butanoate
coenzyme B(3-)
MNXM90724is deprecated and replaced by this entry
MNXM91149is deprecated and replaced by this entry
MNXM91528is deprecated and replaced by this entry