Feedback

(S)-methylmalonate semialdehyde

PropertiesImageOccurences in reactions
MNX_IDMNXM933Image of MNXM933
#reac
in my sandbox 0
in MNXref (generic)20
in models (compartimentalized) 7
formulaC4H5O3
charge-1
mass101.0807
referencechebi:62413
InChIKeyVOKUMXABRRXHAR-VKHMYHEASA-M
InChIInChI=1S/C4H6O3/c1-3(2-5)4(6)7/h2-3H,1H3,(H,6,7)/p-1/t3-/m0/s1
SMILESC[C@@H](C=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:62413
chebi:62413
(S)-methylmalonate semialdehyde
(2S)-2-methyl-3-oxopropanoate
(S)-2-methyl-3-oxopropanoate (1-)
(S)-Me-malonate-semialdehyde(1-)
(S)-ch3-malonate-semialdehyde (1-)
bigg.metabolite:mmtsa
biggM:mmtsa
sabiork.compound:2848
sabiorkM:2848
kegg.compound:C06002
keggC:C06002
(S)-Methylmalonate semialdehyde
seed.compound:cpd19044
seedM:cpd19044
(S)-Methylmalonate semialdehyde
(S)-2-methyl-3-oxopropanoate
(S)-ch3-malonate-semialdehyde
(S)-methylmalonate-semialdehyde
hmdb:HMDB0002217 (S)-Methylmalonic acid semialdehyde
(2S)-2-Methyl-3-oxopropanoate
(2S)-2-Methyl-3-oxopropanoic acid
(2S)-2-methyl-3-oxopropanoic acid
(S)-Methylmalonate semialdehyde
(S)-methylmalonaldehydic acid
lipidmaps:LMFA01060190
lipidmapsM:LMFA01060190
(S)-Methylmalonic acid semialdehyde
2S-methyl-3-oxo-propanoic acid
FA(4:0(Ke))
CHEBI:27821
chebi:27821
(S)-methylmalonaldehydic acid
(2S)-2-methyl-3-oxopropanoic acid
(S)-Methylmalonate semialdehyde
metacyc.compound:CH3-MALONATE-S-ALD
metacycM:CH3-MALONATE-S-ALD
(S)-methylmalonate-semialdehyde
(S)-2-methyl-3-oxopropanoate
(S)-ch3-malonate-semialdehyde
hmdb:HMDB02217
chebi:18789
chebi:427
biggM:M_mmtsa
keggC:M_C06002
seedM:M_cpd19044
secondary/obsolete/fantasy identifier