Feedback

(S)-methylmalonate semialdehyde

Properties
MNX_IDMNXM933
formulaC4H5O3
charge-1
mass101.0807
referencechebi:62413
Image of MNXM933
InChIKeyVOKUMXABRRXHAR-VKHMYHEASA-M
InChIInChI=1S/C4H6O3/c1-3(2-5)4(6)7/h2-3H,1H3,(H,6,7)/p-1/t3-/m0/s1
SMILESC[C@@H](C=O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref19
Distinct compatimentalized reactions in models5

Similar chemical compounds in external resources
IdentifierDescription
chebi:27821 (S)-methylmalonaldehydic acid
(2S)-2-methyl-3-oxopropanoic acid
(S)-Methylmalonate semialdehyde
lipidmaps:LMFA01060190 (S)-Methylmalonic acid semialdehyde
2S-methyl-3-oxo-propanoic acid
FA(4:0(Ke))
metacycM:CH3-MALONATE-S-ALD (S)-methylmalonate-semialdehyde
(S)-2-methyl-3-oxopropanoate
(S)-ch3-malonate-semialdehyde
chebi:62413 (S)-methylmalonate semialdehyde
(2S)-2-methyl-3-oxopropanoate
(S)-2-methyl-3-oxopropanoate (1-)
(S)-Me-malonate-semialdehyde(1-)
(S)-ch3-malonate-semialdehyde (1-)
biggM:mmtsa
keggC:C06002
sabiorkM:2848
(S)-Methylmalonate semialdehyde
seedM:cpd19044 (S)-Methylmalonate semialdehyde
(S)-2-methyl-3-oxopropanoate
(S)-ch3-malonate-semialdehyde
(S)-methylmalonate-semialdehyde
biggM:M_mmtsa
chebi:18789
chebi:427
hmdb:HMDB02217
keggC:M_C06002
seedM:M_cpd19044
secondary/obsolete/fantasy identifier
hmdb:HMDB0002217 (S)-Methylmalonic acid semialdehyde
(2S)-2-Methyl-3-oxopropanoate
(2S)-2-Methyl-3-oxopropanoic acid
(2S)-2-methyl-3-oxopropanoic acid
(S)-Methylmalonate semialdehyde
(S)-methylmalonaldehydic acid