Feedback

2,5-didehydro-D-gluconate

Properties
MNX_IDMNXM936
formulaC6H7O7
charge-1
mass191.11558
referencechebi:11449
Image of MNXM936
InChIKeyRXMWXENJQAINCC-DMTCNVIQSA-M
InChIInChI=1S/C6H8O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h3-4,7,9-10H,1H2,(H,12,13)/p-1/t3-,4+/m1/s1
SMILESOCC(=O)[C@@H](O)[C@H](O)C(=O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref13
Distinct compatimentalized reactions in models7

Similar chemical compounds in external resources
IdentifierDescription
chebi:18281 2,5-didehydro-D-gluconic acid
2,5-Diketogluconic acid
2,5-Dioxo-D-gluconic acid
2,5-diketo-D-gluconic acid
D-threo-2,5-Hexodiulosonic acid
D-threo-hexo-2,5-diulosonic acid
keggC:C02780 2,5-Didehydro-D-gluconate
2,5-Diketogluconic acid
metacycM:25-DIDEHYDRO-D-GLUCONATE 2,5-didehydro-D-gluconate
2,5-diketo-D-gluconate
2,5-diketogluconic acid
chebi:11449 2,5-didehydro-D-gluconate
2,5-Didehydro-D-gluconate
2,5-diketo-D-gluconate
2,5-diketogluconate
2-Dehydro-L-idonate
D-threo-2,5-hexodiulosonate
D-threo-hexo-2,5-diulosonate
lipidmaps:LMFA01050471 2,5-didehydro-D-gluconic acid
2,5-Dioxo-D-gluconic acid
2,5-didehydro-D-gluconic acid
2,5-diketo-D-gluconic acid
D-threo-2,5-Hexodiulosonic acid
D-threo-hexo-2,5-diulosonic acid
FA(6:0(OH3,KE2))
seedM:cpd01793 2,5-diketo-D-gluconate
2,5-Didehydro-D-gluconate
2,5-Diketogluconic acid
2,5-didehydro-D-gluconate
2,5-diketogluconic acid
25dkglcn
biggM:25dkglcn 2,5-diketo-D-gluconate
biggM:M_25dkglcn
chebi:1070
chebi:19378
chebi:58428
keggC:M_C02780
seedM:M_cpd01793
secondary/obsolete/fantasy identifier