Feedback

 

desferrioxamine B

Image of MNXM94790
Properties
MNX_IDMNXM94790
formulaC25H49N6O8
charge1
mass561.6914
referencechebi:4356
InChIKeyUBQYURCVBFRUQT-UHFFFAOYSA-O
InChIInChI=1S/C25H48N6O8/c1-21(32)29(37)18-9-3-6-16-27-22(33)12-14-25(36)31(39)20-10-4-7-17-28-23(34)11-13-24(35)30(38)19-8-2-5-15-26/h37-39H,2-20,26H2,1H3,(H,27,33)(H,28,34)/p+1
SMILESCC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCC[NH3+]

This chemical compound does not exist in my selection



Occurrences of desferrioxamine B in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:4356 DFO
Deferoxamin
Deferrioxamine
Desferrioxamine
N'-{5-[acetyl(hydroxy)amino]pentyl}-N-(5-{4-[(5-aminopentyl)(hydroxy)amino]-4-oxobutanamido}pentyl)-N-hydroxybutanediamide
UBQYURCVBFRUQT-UHFFFAOYSA-N
deferoxamina
deferoxamine
deferoxaminum
deferrioxamine B
desferrioxamine B
chebi:84700 ZTZKLNOYBOAHJQ-UHFFFAOYSA-N
[acetyl(27-amino-11,22-dioxido-7,10,18,21-tetraoxo-6,11,17,22-tetraazaheptacos-1-yl)amino]oxidanide
desferrioxamine B(3-)
hmdb:HMDB14884 Deferoxamine
N-(5-aminopentyl)-N-hydroxy-N'-[5-(N-hydroxy-3-{[5-(N-hydroxyacetamido)pentyl]carbamoyl}propanamido)pentyl]butanediamide
N-(5-aminopentyl)-N-hydroxy-N'-[5-(N-hydroxy-3-{[5-(N-hydroxyacetamido)pentyl]carbamoyl}propanamido)pentyl]succinamide
kegg:C06940
kegg:D03670
Deferoxamine
Deferoxamine (USAN)
lipidmaps:LMFA08020169 Deferoxamine
N-(5-aminopentyl)-N-hydroxy-N'-[5-(N-hydroxy-3-{[5-(N-hydroxyacetamido)pentyl]carbamoyl}propanamido)pentyl]butanediamide
lipidmaps:LMFA08020169
metacyc:CPD-3764 CPD-3764
deferoxamine
deferrioxamine B
desferrioxamine B
seed:cpd04273 Deferoxamine
seed:cpd23947 deferoxamine
deferrioxamine B
desferrioxamine B