Feedback

 

UDP-N-acetyl-alpha-D-muramoyl-L-alanyl-D-glutamate

Image of MNXM955
Properties
MNX_IDMNXM955
formulaC28H39N5O23P2
charge-4
mass875.5787
referencechebi:83900
InChIKeyOJZCATPXPWFLHF-HPUCEMLMSA-J
InChIInChI=1S/C28H43N5O23P2/c1-10(23(42)31-13(26(44)45)4-5-17(37)38)29-24(43)11(2)52-22-18(30-12(3)35)27(54-14(8-34)20(22)40)55-58(49,50)56-57(47,48)51-9-15-19(39)21(41)25(53-15)33-7-6-16(36)32-28(33)46/h6-7,10-11,13-15,18-22,25,27,34,39-41H,4-5,8-9H2,1-3H3,(H,29,43)(H,30,35)(H,31,42)(H,37,38)(H,44,45)(H,47,48)(H,49,50)(H,32,36,46)/p-4/t10-,11+,13+,14+,15+,18+,19+,20+,21+,22+,25+,27+/m0/s1
SMILESC[C@H](NC(=O)[C@@H](C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP([O-])(=O)OP([O-])(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)n2ccc(=O)[nH]c2=O)[C@@H]1NC(C)=O)C(=O)N[C@H](CCC([O-])=O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of UDP-N-acetyl-alpha-D-muramoyl-L-alanyl-D-glutamate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:46143 OJZCATPXPWFLHF-HPUCEMLMSA-N
UDP-N-acetyl-alpha-muramoyl-L-alanyl-D-glutamic acid
URIDINE-5'-DIPHOSPHATE-N-ACETYLMURAMOYL-L-ALANINE-D-GLUTAMATE
chebi:83900 OJZCATPXPWFLHF-HPUCEMLMSA-J
UDP-N-acetyl-alpha-D-muramoyl-L-alanyl-D-glutamate
UDP-N-acetyl-alpha-D-muramoyl-L-alanyl-D-glutamate(4-)
metacyc:UDP-AA-GLUTAMATE UDP-AA-GLUTAMATE
UDP-N-acetyl-alpha-D-muramoyl-L-alanyl-D-glutamate
UDP-N-acetyl-alpha-D-muramoyl-L-alanyl-D-glutamate tetraanion
uridine 5'-(3-{2-acetamido-2-deoxy-3-O-[(2R)-1-{[(2S)-1-D-glutamato-1-oxopropan-2-yl]amino}-1-oxopropan-2-yl]-D-glucopyranosyl} diphosphate)