Feedback

1-pyrroline-2-carboxylate

Properties
MNX_IDMNXM957
formulaC5H7NO2
charge0
mass113.11462
referencechebi:39785
Image of MNXM957
InChIKeyRHTAIKJZSXNELN-UHFFFAOYSA-N
InChIInChI=1S/C5H7NO2/c7-5(8)4-2-1-3-6-4/h1-3H2,(H,7,8)
SMILES[O-]C(=O)C1=[NH+]CCC1

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref16
Distinct compatimentalized reactions in models5

Similar chemical compounds in external resources
IdentifierDescription
chebi:39785 1-pyrroline-2-carboxylate
1-pyrroline-2-carboxylic acid zwitterion
3,4-dihydro-2H-pyrrolium-5-carboxylate
chebi:36761 1-pyrroline-2-carboxylic acid
1-Pyrroline-2-carboxylate
1-Pyrroline-2-carboxylic acid
3,4-dihydro-2H-pyrrole-5-carboxylic acid
delta1-Pyrroline 2-carboxylate
metacycM:DELTA1-PYRROLINE_2-CARBOXYLATE 1-pyrroline-2-carboxylate
1-pyrroline-2-carboxylic acid
4,5-dihydro-3H-pyrrole-2-carboxylate
Delta1-pyrroline-2-carboxylate
sabiorkM:6702 1-Pyrroline-2-carboxylate
1-Pyrroline-2-carboxylic acid
seedM:cpd26844 1-pyrroline 2-carboxylate
4,5-dihydro-3H-pyrrole-2-carboxylate
delta-(1)-pyrroline 2-carboxylate
delta1-pyrroline-2-carboxylate
keggC:C03564 1-Pyrroline-2-carboxylate
1-Pyrroline 2-carboxylate
1-Pyrroline-2-carboxylic acid
Delta1-Pyrroline 2-carboxylate
chebi:17425 1-pyrroline-2-carboxylate
3,4-dihydro-2H-pyrrole-5-carboxylate
Delta(1)-pyrroline 2-carboxylate
hmdb:HMDB0006875 1-Pyrroline-2-carboxylic acid
1-Pyrroline-2-carboxylate
3,4-dihydro-2H-Pyrrole-5-carboxylate
3,4-dihydro-2H-Pyrrole-5-carboxylic acid
3,4-dihydro-2H-pyrrol-1-ium-5-carboxylate
4,5-dihydro-3H-pyrrol-1-ium-2-carboxylate
D1-Pyrroline 2-carboxylate
D1-Pyrroline 2-carboxylic acid
delta-1-Pyrroline-2-carboxylate
delta1-Pyrroline 2-carboxylate
delta1-Pyrroline 2-carboxylic acid
delta1-pyrroline 2-carboxylate
delta1-pyrroline 2-carboxylic acid
biggM:1p2cbxl 1-Pyrroline-2-carboxylate
sabiorkM:7027 delta1-Pyrroline 2-carboxylate
biggM:M_1p2cbxl
chebi:10540
chebi:11295
chebi:12279
chebi:19093
chebi:216985
chebi:23602
chebi:683
hmdb:HMDB06875
keggC:M_C03564
seedM:M_cpd02235
seedM:M_cpd26844
secondary/obsolete/fantasy identifier
seedM:cpd02235 1-Pyrroline-2-carboxylate
1-Pyrroline 2-carboxylate
1-Pyrroline-2-carboxylic acid
1-pyrroline-2-carboxylate
1-pyrroline-2-carboxylic acid
delta1-Pyrroline 2-carboxylate
MNXM165560is deprecated and replaced by this entry
MNXM6477is deprecated and replaced by this entry