Feedback

1-pyrroline-2-carboxylate

PropertiesImageOccurences in reactions
MNX_IDMNXM957Image of MNXM957
#reac
in my sandbox 0
in MNXref (generic)16
in models (compartimentalized) 5
formulaC5H7NO2
charge0
mass113.11462
referencechebi:39785
InChIKeyRHTAIKJZSXNELN-UHFFFAOYSA-N
InChIInChI=1S/C5H7NO2/c7-5(8)4-2-1-3-6-4/h1-3H2,(H,7,8)
SMILES[O-]C(=O)C1=[NH+]CCC1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:39785
chebi:39785
1-pyrroline-2-carboxylate
1-pyrroline-2-carboxylic acid zwitterion
3,4-dihydro-2H-pyrrolium-5-carboxylate
bigg.metabolite:1p2cbxl
biggM:1p2cbxl
1-Pyrroline-2-carboxylate
seed.compound:cpd02235
seedM:cpd02235
1-Pyrroline-2-carboxylate
1-Pyrroline 2-carboxylate
1-Pyrroline-2-carboxylic acid
1-pyrroline-2-carboxylate
1-pyrroline-2-carboxylic acid
delta1-Pyrroline 2-carboxylate
kegg.compound:C03564
keggC:C03564
1-Pyrroline-2-carboxylate
1-Pyrroline 2-carboxylate
1-Pyrroline-2-carboxylic acid
Delta1-Pyrroline 2-carboxylate
sabiork.compound:6702
sabiorkM:6702
1-Pyrroline-2-carboxylate
1-Pyrroline-2-carboxylic acid
hmdb:HMDB0006875 1-Pyrroline-2-carboxylic acid
1-Pyrroline-2-carboxylate
3,4-dihydro-2H-Pyrrole-5-carboxylate
3,4-dihydro-2H-Pyrrole-5-carboxylic acid
3,4-dihydro-2H-pyrrol-1-ium-5-carboxylate
4,5-dihydro-3H-pyrrol-1-ium-2-carboxylate
D1-Pyrroline 2-carboxylate
D1-Pyrroline 2-carboxylic acid
delta-1-Pyrroline-2-carboxylate
delta1-Pyrroline 2-carboxylate
delta1-Pyrroline 2-carboxylic acid
delta1-pyrroline 2-carboxylate
delta1-pyrroline 2-carboxylic acid
seed.compound:cpd26844
seedM:cpd26844
1-pyrroline 2-carboxylate
4,5-dihydro-3H-pyrrole-2-carboxylate
delta-(1)-pyrroline 2-carboxylate
delta1-pyrroline-2-carboxylate
metacyc.compound:DELTA1-PYRROLINE_2-CARBOXYLATE
metacycM:DELTA1-PYRROLINE_2-CARBOXYLATE
1-pyrroline-2-carboxylate
1-pyrroline-2-carboxylic acid
4,5-dihydro-3H-pyrrole-2-carboxylate
Delta1-pyrroline-2-carboxylate
CHEBI:17425
chebi:17425
1-pyrroline-2-carboxylate
3,4-dihydro-2H-pyrrole-5-carboxylate
Delta(1)-pyrroline 2-carboxylate
CHEBI:36761
chebi:36761
1-pyrroline-2-carboxylic acid
1-Pyrroline-2-carboxylate
1-Pyrroline-2-carboxylic acid
3,4-dihydro-2H-pyrrole-5-carboxylic acid
delta1-Pyrroline 2-carboxylate
sabiork.compound:7027
sabiorkM:7027
delta1-Pyrroline 2-carboxylate
hmdb:HMDB06875
chebi:10540
chebi:11295
chebi:12279
chebi:19093
chebi:216985
chebi:23602
chebi:683
biggM:M_1p2cbxl
keggC:M_C03564
seedM:M_cpd02235
seedM:M_cpd26844
secondary/obsolete/fantasy identifier