Feedback

 

2,3-diketogulonate

Image of MNXM958
Properties
MNX_IDMNXM958
formulaC6H7O7
charge-1
mass191.1161
referencechebi:57441
InChIKeyGJQWCDSAOUMKSE-STHAYSLISA-M
InChIInChI=1S/C6H8O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-3,7-9H,1H2,(H,12,13)/p-1/t2-,3+/m0/s1
SMILESOC[C@H](O)[C@@H](O)C(=O)C(=O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of 2,3-diketogulonate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:23doguln 2,3-Dioxo-L-gulonate
chebi:10900
chebi:15622
chebi:18578
chebi:226
chebi:60793
(4R,5S)-2,3-dioxo-4,5,6-trihydroxyhexanoic acid
(4R,5S)-4,5,6-Trihydroxy-2,3-dioxohexanoate
(4R,5S)-4,5,6-trihydroxy-2,3-dioxohexanoate
(4R,5S)-4,5,6-trihydroxy-2,3-dioxohexanoic acid
2,3-Diketo-L-gulonate
2,3-L-diketogulonic acid
2,3-diketo-L-gulonic acid
2,3-diketogulonic acid
2,3-dioxo-2,3-dideoxy-L-gulonic acid
GJQWCDSAOUMKSE-STHAYSLISA-N
L-threo-(2,3)-Hexodiulosonsaeure
L-threo-2,3-hexodiurosonic acid
L-threo-hexo-2,3-diulosonic acid
diketo-L-gulonic acid
threo-2,3-Hexodiulosonic acid
chebi:57441 (4R,5S)-4,5,6-trihydroxy-2,3-dioxohexanoate
2,3-diketo-L-gulonate
2,3-diketogulonate
2,3-dioxo-L-gulonate(1-)
2,3-dioxo-L-gulonic
GJQWCDSAOUMKSE-STHAYSLISA-M
L-threo-hexo-2,3-diulosonate
hmdb:HMDB05971 (4R,5S)-4,5,6-trihydroxy-2,3-dioxohexanoic acid
Diketogulonic acid
diketogulonic acid
hmdb:HMDB06511 (5S)-4,5,6-trihydroxy-2,3-dioxohexanoic acid
2,3-Diketo-L-gulonate
hmdb:HMDB62803 (4R,5S)-4,5,6-trihydroxy-2,3-dioxohexanoate
2,3-diketo-L-gulonate
2,3-diketogulonate
kegg:C04575 (4R,5S)-4,5,6-Trihydroxy-2,3-dioxohexanoate
2,3-Diketo-L-gulonate
lipidmaps:LMFA01060195 2,3-dioxo-4R,5S,6-trihydroxy-hexanoic acid
diketo-gulonic acid
lipidmaps:LMFA01060195
metacyc:CPD-19692 2,3-diketogulonate
2,3-diketogulonic acid
CPD-19692
L-threo-Hexo-2,3-diulosonic acid
metacyc:CPD-334 (4R,5S)-4,5,6-trihydroxy-2,3-dioxohexanoate
2,3-diketo-L-gulonate
2,3-dioxo-L-gulonate
CPD-334
DKG
L-xylo-hex-2-enonate
L-xylo-hex-2-enonic acid
sabiork:25315 2,3-Diketogulonate
seed:cpd02784 (4R,5S)-4,5,6-Trihydroxy-2,3-dioxohexanoate
2,3-Diketo-L-gulonate
2,3-Dioxo-L-gulonate
23doguln
deprecated:MNXM34446