Feedback

5-dehydro-D-gluconate

PropertiesImageOccurences in reactions
MNX_IDMNXM963Image of MNXM963
#reac
in my sandbox 0
in MNXref (generic)12
in models (compartimentalized) 12
formulaC6H9O7
charge-1
mass193.13146
referencechebi:58143
InChIKeyIZSRJDGCGRAUAR-MROZADKFSA-M
InChIInChI=1S/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h3-5,7,9-11H,1H2,(H,12,13)/p-1/t3-,4+,5-/m1/s1
SMILESOCC(=O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58143
chebi:58143
5-dehydro-D-gluconate
5-dehydro-D-gluconate anion
5-dehydro-D-gluconate(1-)
5-ketogluconate
5-ketolactonate
D-xylo-hex-5-ulosonate
bigg.metabolite:5dglcn
biggM:5dglcn
5-Dehydro-D-gluconate
sabiork.compound:2233
sabiorkM:2233
kegg.compound:C01062
keggC:C01062
5-Dehydro-D-gluconate
5-Dehydrogluconate
seed.compound:cpd00781
seedM:cpd00781
5-Dehydrogluconate
5-Dehydro-D-gluconate
5-Keto-D-gluconic acid
5-dehydro-D-gluconate
5-dehydrogluconate
5-keto-D-gluconate
5-keto-D-gluconic acid
5-ketogluconate
5dglcn
D-xylo-Hex-5-ulosonic acid
hmdb:HMDB0011731 5-Keto-D-gluconate
2,3,4,6-tetrahydroxy-5-oxohexanoic acid
5-Dehydrogluconate
5-Dehydrogluconic acid
5-K-Gluconate
5-Ketogluconate
5-dehydro-D-Gluconate
5-keto-D-Gluconic acid
5K-Gluconate
D-Tagaturonate
D-Tagaturonic acid
D-xylo-5-hexulosonic acid
Hex-5-ulosonic acid
Tagaturonate
metacyc.compound:5-DEHYDROGLUCONATE
metacycM:5-DEHYDROGLUCONATE
5-dehydro-D-gluconate
5-dehydrogluconate
5-keto-D-gluconate
5-keto-D-gluconic acid
5-ketogluconate
CHEBI:17426
chebi:17426
5-dehydro-D-gluconic acid
5-Dehydro-D-gluconate
5-Dehydrogluconate
5-dehydro-D-gluconate
D-xylo-hex-5-ulosonic acid
hmdb:HMDB11731
chebi:12120
chebi:12121
chebi:2051
chebi:20564
biggM:M_5dglcn
keggC:M_C01062
seedM:M_cpd00781
secondary/obsolete/fantasy identifier