Feedback

D-aspartate

Properties
MNX_IDMNXM974
formulaC4H6NO4
charge-1
mass132.09478
referencechebi:29990
Image of MNXM974
InChIKeyCKLJMWTZIZZHCS-UWTATZPHSA-M
InChIInChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/p-1/t2-/m1/s1
SMILES[NH3+][C@H](CC([O-])=O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref24
Distinct compatimentalized reactions in models7

Similar chemical compounds in external resources
IdentifierDescription
hmdb:HMDB0006483 D-Aspartic acid
(-)-Aspartic acid
(2R)-2-Aminobutanedioate
(2R)-2-Aminobutanedioic acid
(2R)-2-aminobutanedioic acid
(R)-2-Aminobutanedioate
(R)-2-Aminobutanedioic acid
(R)-2-Aminosuccinate
(R)-2-Aminosuccinic acid
(R)-Aspartic acid
1-amino-1,2-Carboxyethane
Aspartate D-form
Aspartic acid
Aspartic acid D-form
D Aspartate
D Aspartic acid
D-(-)-Aspartic acid
D-Asparaginsaeure
D-Aspartate
D-aspartic acid
DAS
Lopac-alpha-9256
Tocris-0213
delta-(-)-Aspartic acid
delta-Asparaginsaeure
delta-Aspartate
delta-Aspartic acid
chebi:17364
reactome:R-ALL-427953
reactome:R-ALL-428044
D-aspartic acid
(2R)-2-aminobutanedioic acid
(R)-2-aminobutanedioic acid
(R)-2-aminosuccinic acid
D-Asparaginsaeure
D-Aspartic acid
DAS
aspartic acid D-form
chebi:29994 D-aspartate(2-)
(2R)-2-aminobutanedioate
(2R)-2-aminosuccinate
D-aspartate
D-aspartic acid dianion
seedM:cpd00320 D-Aspartate
D-Aspartic acid
D-aspartate
D-aspartic acid
cll_345
metacycM:CPD-302 D-aspartate
D-aspartic acid
chebi:29990 D-aspartate
(2R)-2-ammoniobutanedioate
(2R)-2-ammoniosuccinate
D-aspartate(1-)
D-aspartic acid monoanion
hydrogen D-aspartate
keggC:C00402
sabiorkM:2041
D-Aspartate
D-Aspartic acid
biggM:M_asp__D
chebi:12918
chebi:20919
chebi:20920
chebi:4108
hmdb:HMDB06483
keggC:M_C00402
seedM:M_cpd00320
secondary/obsolete/fantasy identifier
biggM:asp__D
envipath:...924a156626b4
D-Aspartate