Feedback

(S)-malate

PropertiesImageOccurences in reactions
MNX_IDMNXM98Image of MNXM98
#reac
in my sandbox 0
in MNXref (generic)92
in models (compartimentalized) 59
formulaC4H4O5
charge-2
mass132.07156
referencechebi:15589
InChIKeyBJEPYKJPYRNKOW-REOHCLBHSA-L
InChIInChI=1S/C4H6O5/c5-2(4(8)9)1-3(6)7/h2,5H,1H2,(H,6,7)(H,8,9)/p-2/t2-/m0/s1
SMILESO[C@@H](CC([O-])=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:15589
chebi:15589
(S)-malate
(2S)-2-hydroxybutanedioate
(S)-malate(2-)
L-malate
kegg.compound:C00149
keggC:C00149
(S)-Malate
L-2-Hydroxybutanedioic acid
L-Apple acid
L-Malate
L-Malic acid
Malate
Malic acid
metacyc.compound:MAL
metacycM:MAL
(S)-malate
(S)-malic acid
L-apple acid
L-hydroxybutanedioic acid
L-hydroxysuccinic acid
L-malate
L-malic acid
reactome:R-ALL-113544
reactomeM:R-ALL-113544
reactome:R-ALL-198498
reactomeM:R-ALL-198498
CHEBI:30797
chebi:30797
(S)-malic acid
(-)-L-malic acid
(2S)-2-hydroxybutanedioic acid
(S)-(-)-Hydroxysuccinic acid
L-2-Hydroxybutanedioic acid
L-Apple acid
L-Malic acid
L-malic acid
Malate
Malic acid
S-2-Hydroxybutanedioic acid
bigg.metabolite:mal__L
biggM:mal__L
L-Malate
seed.compound:cpd00130
seedM:cpd00130
L-Malate
(S)-Malate
(S)-malate
(S)-malic acid
L-2-Hydroxybutanedioic acid
L-Apple acid
L-Malic acid
L-apple acid
L-hydroxybutanedioic acid
L-hydroxysuccinic acid
L-mal
L-malate
L-malic acid
MALA
Malate
Malic acid
hydroxybutanedioic acid
hydroxysuccinic acid
mal
mal-L
malate
malic acid
sabiork.compound:1918
sabiorkM:1918
L-Malate
(S)-Malate
L-2-Hydroxybutanedioic acid
L-Apple acid
L-Malic acid
hmdb:HMDB0000156 L-Malic acid
(-)-(S)-Malate
(-)-(S)-Malic acid
(-)-Hydroxysuccinate
(-)-Hydroxysuccinic acid
(-)-L-Malate
(-)-L-Malic acid
(-)-Malic acid
(-)-malic acid
(2S)-2-Hydroxybutanedioate
(2S)-2-Hydroxybutanedioic acid
(2S)-2-hydroxybutanedioic acid
(S)-(-)-Hydroxysuccinate
(S)-(-)-Hydroxysuccinic acid
(S)-Hydroxy-butanedioate
(S)-Hydroxy-butanedioic acid
(S)-Hydroxybutanedioate
(S)-Hydroxybutanedioic acid
(S)-Malic acid
Apple acid
L-(-)-Malic acid
L-2-Hydroxybutanedioate
L-2-Hydroxybutanedioic acid
L-Apple acid
L-Hydroxybutanedioate
L-Hydroxybutanedioic acid
L-Hydroxysuccinate
L-Hydroxysuccinic acid
L-Malate
Malate
Malic acid
S-(-)-Malate
S-(-)-Malic acid
S-2-Hydroxybutanedioate
S-2-Hydroxybutanedioic acid
biggM:mal-L
hmdb:HMDB00156
chebi:11066
chebi:13140
chebi:18784
chebi:18785
chebi:423
biggM:M_mal__L
keggC:M_C00149
seedM:M_cpd00130
secondary/obsolete/fantasy identifier