Feedback

4-hydroxy-3-methoxybenzoate

PropertiesImageOccurences in reactions
MNX_IDMNXM982Image of MNXM982
#reac
in my sandbox 0
in MNXref (generic)24
in models (compartimentalized) 5
formulaC8H7O4
charge-1
mass167.13878
referencechebi:16632
InChIKeyWKOLLVMJNQIZCI-UHFFFAOYSA-M
InChIInChI=1S/C8H8O4/c1-12-7-4-5(8(10)11)2-3-6(7)9/h2-4,9H,1H3,(H,10,11)/p-1
SMILESCOc1cc(ccc1O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:16632
chebi:16632
4-hydroxy-3-methoxybenzoate
4-HYDROXY-3-METHOXYBENZOATE
vanillate
bigg.metabolite:vanlt
biggM:vanlt
envipath:...302e0e0e0933
envipathM:...302e0e0e0933
Vanillate
sabiork.compound:8830
sabiorkM:8830
Vanillate
4-Hydroxy-3-methoxybenzoate
4-Hydroxy-3-methoxybenzoic acid
seed.compound:cpd04073
seedM:cpd04073
Vanillate
4-Hydroxy-3-methoxybenzoate
4-Hydroxy-3-methoxybenzoic acid
4-hydroxy-3-methoxybenzoate
4-hydroxy-3-methoxybenzoic acid
Vanillic acid
vanillate
vanillic acid
vanlt
kegg.compound:C06672
keggC:C06672
Vanillate
4-Hydroxy-3-methoxybenzoate
4-Hydroxy-3-methoxybenzoic acid
Vanillic acid
hmdb:HMDB0000484 Vanillic acid
3-Methoxy-4-hydroxybenzoate
3-Methoxy-4-hydroxybenzoic acid
4 Hydroxy 3 methoxybenzoic acid
4-Hydroxy-3-methoxy-benzoate
4-Hydroxy-3-methoxy-benzoic acid
4-Hydroxy-3-methoxybenzoate
4-Hydroxy-3-methoxybenzoic acid
4-Hydroxy-m-anisate
4-Hydroxy-m-anisic acid
4-hydroxy-3-methoxybenzoic acid
Acid, 4-hydroxy-3-methoxybenzoic
Acid, P-hydroxy-m-methoxy-benzoic
Acid, vanillic
Acide vanillique
P Hydroxy m methoxy benzoic acid
P-Hydroxy-m-methoxy-benzoic acid
P-Vanillate
P-Vanillic acid
Protocatechuic acid 3-methyl ester
Vanillate
vanillic acid
metacyc.compound:VANILLATE
metacycM:VANILLATE
vanillate
4-hydroxy-3-methoxybenzoate
4-hydroxy-3-methoxybenzoic acid
vanillic acid
CHEBI:30816
chebi:30816
vanillic acid
4-Hydroxy-3-methoxybenzoic acid
4-hydroxy-3-methoxybenzoic acid
Vanillic acid
hmdb:HMDB00484
chebi:15301
chebi:27277
chebi:27278
chebi:46315
chebi:9933
biggM:M_vanlt
keggC:M_C06672
seedM:M_cpd04073
secondary/obsolete/fantasy identifier