Feedback

(1R,2S)-homoisocitrate

Properties
MNX_IDMNXM984
formulaC7H7O7
charge-3
mass203.12628
referencechebi:15404
Image of MNXM984
InChIKeyOEJZZCGRGVFWHK-WVZVXSGGSA-K
InChIInChI=1S/C7H10O7/c8-4(9)2-1-3(6(11)12)5(10)7(13)14/h3,5,10H,1-2H2,(H,8,9)(H,11,12)(H,13,14)/p-3/t3-,5+/m0/s1
SMILESO[C@H]([C@H](CCC([O-])=O)C([O-])=O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref4
Distinct compatimentalized reactions in models6

Similar chemical compounds in external resources
IdentifierDescription
chebi:36455 homoisocitrate(2-)
hydrogen 1-hydroxybutane-1,2,4-tricarboxylate
hydrogen homoisocitrate
chebi:36456 homoisocitrate(1-)
dihydrogen 1-hydroxybutane-1,2,4-tricarboxylate
dihydrogen homoisocitrate
keggC:C05662 Homoisocitrate
(-)-1-Hydroxy-1,2,4-butanetricarboxylate
(-)-threo-Homoisocitrate
(1R,2S)-1-Hydroxybutane-1,2,4-tricarboxylate
3-Carboxy-2-hydroxyadipate
chebi:29094 homoisocitric acid
1-hydroxybutane-1,2,4-tricarboxylic acid
3-carboxy-2-hydroxyadipic acid
chebi:15404 (1R,2S)-homoisocitrate
(-)-1-Hydroxy-1,2,4-butanetricarboxylate
(-)-homoisocitrate(3-)
(1R,2S)-1-Hydroxybutane-1,2,4-tricarboxylate
(1R,2S)-1-hydroxybutane-1,2,4-tricarboxylate
seedM:cpd03372 Homoisocitrate
(-)-1-Hydroxy-1,2,4-butanetricarboxylate
(-)-1-hydroxy-1,2,4-butanetricarboxylate
(-)-threo-Homoisocitrate
(-)-threo-isohomocitrate
(1R,2S)-1-Hydroxybutane-1,2,4-tricarboxylate
(1R,2S)-1-hydroxybutane-1,2,4-tricarboxylate
(1R,2S)-homoisocitrate
1-(R)-hydroxy-2-(S)-1,2,4-butanetricarboxylic acid
1-Hydroxybutane-1,2,4-tricarboxylate
1-hydroxy-1,2,4-butanetricarboxylate
1-hydroxybutane-1,2,4-tricarboxylate
2-hydroxy-3-carboxyadipate
3-Carboxy-2-hydroxyadipate
hicit
homo-I-cit
homo-iso-citrate
homoisocitrate
threo-isohomocitrate
chebi:30904 homoisocitrate(3-)
1-Hydroxybutane-1,2,4-tricarboxylate
1-hydroxybutane-1,2,4-tricarboxylate
3-Carboxy-2-hydroxyadipate
Homoisocitrate
homoisocitrate
biggM:M_hicit
chebi:10767
chebi:11761
chebi:18469
chebi:19972
chebi:24617
chebi:24618
chebi:5756
keggC:M_C05662
seedM:M_cpd03372
secondary/obsolete/fantasy identifier
chebi:30903 (-)-homoisocitric acid
(1R,2S)-1-hydroxybutane-1,2,4-tricarboxylic acid
sabiorkM:2824 Homoisocitrate
(-)-1-Hydroxy-1,2,4-butanetricarboxylate
(1R,2S)-1-Hydroxybutane-1,2,4-tricarboxylate
1-(R)-hydroxy-2-(S)-1,2,4-butanetricarboxylic acid
1-Hydroxybutane-1,2,4-tricarboxylate
3-Carboxy-2-hydroxyadipate
biggM:hicit Homoisocitrate
metacycM:HOMO-I-CIT (1R,2S)-homoisocitrate
(-)-1-hydroxy-1,2,4-butanetricarboxylate
(-)-threo-isohomocitrate
(1R,2S)-1-hydroxybutane-1,2,4-tricarboxylate
1-(R)-hydroxy-2-(S)-1,2,4-butanetricarboxylic acid
1-hydroxy-1,2,4-butanetricarboxylate
1-hydroxybutane-1,2,4-tricarboxylate
2-hydroxy-3-carboxyadipate
homo-I-cit
homo-iso-citrate
homoisocitrate
MNXM722762is deprecated and replaced by this entry