Feedback

(2R)-2-hydroxy-3-(4-hydroxyphenyl)propanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM988Image of MNXM988
#reac
in my sandbox 0
in MNXref (generic)8
in models (compartimentalized) 11
formulaC9H9O4
charge-1
mass181.05063
referencechebi:10980
InChIKeyJVGVDSSUAVXRDY-MRVPVSSYSA-M
InChIInChI=1S/C9H10O4/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,8,10-11H,5H2,(H,12,13)/p-1/t8-/m1/s1
SMILESO=C([O-])[C@H](O)Cc1ccc(O)cc1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:10980
chebi:10980
(2R)-2-hydroxy-3-(4-hydroxyphenyl)propanoate
(R)-3-(4-Hydroxyphenyl)lactate
(R)-3-(4-hydroxyphenyl)lactate
kegg.compound:C03964
keggC:C03964
(R)-3-(4-Hydroxyphenyl)lactate
seed.compound:cpd02461
seedM:cpd02461
(R)-3-(4-Hydroxyphenyl)lactate
(R)-3-(4-hydroxyphenyl)lactate
(R+)-3-(4-hydroxyphenyl)lactate
R(+)-4-hydroxyphenyllactate
R(+)-4-hydroxyphenyllactic acid
metacyc.compound:CPD-2222
metacycM:CPD-2222
(R)-3-(4-hydroxyphenyl)lactate
(R+)-3-(4-hydroxyphenyl)lactate
R(+)-4-hydroxyphenyllactate
R(+)-4-hydroxyphenyllactic acid
p-hydroxyphenyllactate
CHEBI:16003
chebi:16003
(R)-3-(4-hydroxyphenyl)lactic acid
(2R)-2-hydroxy-3-(4-hydroxyphenyl)propanoic acid
CHEBI:36659
chebi:36659
2-hydroxy-3-(4-hydroxyphenyl)propanoate
2-Hydroxy-3-(4-hydroxyphenyl)propanoate
3-(4-Hydroxyphenyl)lactate
3-(4-hydroxyphenyl)lactate
4-Hydroxyphenyllactate
p-Hydroxyphenyllactate
bigg.metabolite:34hpl
biggM:34hpl
3 4 Hydroxyphenyl lactate
kegg.compound:C03672
keggC:C03672
3-(4-Hydroxyphenyl)lactate
2-Hydroxy-3-(4-hydroxyphenyl)propanoate
4-Hydroxyphenyllactate
p-Hydroxyphenyllactate
sabiork.compound:6782
sabiorkM:6782
3-(4-Hydroxyphenyl)lactate
4-Hydroxyphenyllactate
p-Hydroxyphenyllactate
metacyc.compound:4-HYDROXYPHENYLLACTATE
metacycM:4-HYDROXYPHENYLLACTATE
3-(4-hydroxyphenyl)lactate
2-hydroxy-3-(4-hydroxyphenyl)propanoate
3-(4-hydroxyphenyl)lactic acid
4-hydroxyphenyllactate
p-hydroxyphenyllactate
CHEBI:17385
chebi:17385
3-(4-hydroxyphenyl)lactic acid
2-Hydroxy-3-(4-hydroxyphenyl)propanoate
2-Hydroxy-3-(p-hydroxyphenyl)propionic acid
2-hydroxy-3-(4-hydroxyphenyl)propanoic acid
4-Hydroxyphenyllactic acid
DL-p-Hydroxyphenyllactic acid
beta-(4-Hydroxyphenyl)lactic acid
beta-(p-Hydroxyphenyl)lactic acid
p-Hydroxyphenyl lactic acid
seed.compound:cpd02305
seedM:cpd02305
HPL
2-Hydroxy-3-(4-hydroxyphenyl)propanoate
3-(4-Hydroxyphenyl)lactate
3-(4-hydroxyphenyl)lactate)
34hpl
4-Hydroxyphenyllactate
4-hydroxyphenyllactate
4-hydroxyphenyllactic acid
p-Hydroxyphenyllactate
p-hydroxyphenyllactate
hmdb:HMDB0000755 Hydroxyphenyllactic acid
(RS)-3-(4-Hydroxyphenyl)lactate
(RS)-3-(4-Hydroxyphenyl)lactic acid
2-Hydroxy-3-(4-hydroxyphenyl)propanoate
2-Hydroxy-3-(4-hydroxyphenyl)propanoic acid
2-Hydroxy-3-(p-hydroxyphenyl)propionate
2-Hydroxy-3-(p-hydroxyphenyl)propionic acid
2-hydroxy-3-(4-hydroxyphenyl)propanoic acid
3-(4-Hydroxyphenyl)-DL-lactate
3-(4-Hydroxyphenyl)-DL-lactic acid
3-(4-Hydroxyphenyl)lactate
3-(4-Hydroxyphenyl)lactic acid
3-(p-Hydroxyphenyl)-lactate
3-(p-Hydroxyphenyl)-lactic acid
4-Hydroxyphenyllactate
4-Hydroxyphenyllactic acid
4-Hydroxyphenyllactic acid, (DL)-isomer
DL-3-(4-Hydroxyphenyl)lactate
DL-3-(4-Hydroxyphenyl)lactic acid
DL-p-Hydroxyphenyllactate
DL-p-Hydroxyphenyllactic acid
HPLA
Hydroxyphenyllactate
Para-hydroxyphenyllactic acid
a,4-Dihydroxybenzenepropanoate
a,4-Dihydroxybenzenepropanoic acid
b-(4-Hydroxyphenyl)lactate
b-(4-Hydroxyphenyl)lactic acid
b-(p-Hydroxyphenyl)-DL-lactate
b-(p-Hydroxyphenyl)-DL-lactic acid
b-(p-Hydroxyphenyl)lactate
b-(p-Hydroxyphenyl)lactic acid
beta-(4-Hydroxyphenyl)lactate
beta-(4-Hydroxyphenyl)lactic acid
beta-(4-hydroxyphenyl)lactate
beta-(4-hydroxyphenyl)lactic acid
beta-(p-Hydroxyphenyl)-DL-lactate
beta-(p-Hydroxyphenyl)-DL-lactic acid
beta-(p-Hydroxyphenyl)lactate
beta-(p-Hydroxyphenyl)lactic acid
beta-(p-hydroxyphenyl)lactate
beta-(p-hydroxyphenyl)lactic acid
hydroxyphenyllactic acid
p-Hydroxyphenyl lactate
p-Hydroxyphenyl lactic acid
p-Hydroxyphenyllactate
p-Hydroxyphenyllactic acid
hmdb:HMDB00755
chebi:1117
chebi:11726
chebi:1430
chebi:18660
chebi:19598
chebi:19600
chebi:19932
chebi:28403
chebi:319
biggM:M_34hpl
keggC:M_C03672
keggC:M_C03964
seedM:M_cpd02305
seedM:M_cpd02461
secondary/obsolete/fantasy identifier