Feedback

(2R)-2-hydroxy-3-(4-hydroxyphenyl)propanoate

Properties
MNX_IDMNXM988
formulaC9H9O4
charge-1
mass181.16536
referencechebi:10980
Image of MNXM988
InChIKeyJVGVDSSUAVXRDY-MRVPVSSYSA-M
InChIInChI=1S/C9H10O4/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,8,10-11H,5H2,(H,12,13)/p-1/t8-/m1/s1
SMILESO[C@H](Cc1ccc(O)cc1)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref8
Distinct compatimentalized reactions in models7

Similar chemical compounds in external resources
IdentifierDescription
chebi:36659 2-hydroxy-3-(4-hydroxyphenyl)propanoate
2-Hydroxy-3-(4-hydroxyphenyl)propanoate
3-(4-Hydroxyphenyl)lactate
3-(4-hydroxyphenyl)lactate
4-Hydroxyphenyllactate
p-Hydroxyphenyllactate
metacycM:CPD-2222 (R)-3-(4-hydroxyphenyl)lactate
(R+)-3-(4-hydroxyphenyl)lactate
R(+)-4-hydroxyphenyllactate
R(+)-4-hydroxyphenyllactic acid
p-hydroxyphenyllactate
keggC:C03672 3-(4-Hydroxyphenyl)lactate
2-Hydroxy-3-(4-hydroxyphenyl)propanoate
4-Hydroxyphenyllactate
p-Hydroxyphenyllactate
chebi:17385 3-(4-hydroxyphenyl)lactic acid
2-Hydroxy-3-(4-hydroxyphenyl)propanoate
2-Hydroxy-3-(p-hydroxyphenyl)propionic acid
2-hydroxy-3-(4-hydroxyphenyl)propanoic acid
4-Hydroxyphenyllactic acid
DL-p-Hydroxyphenyllactic acid
beta-(4-Hydroxyphenyl)lactic acid
beta-(p-Hydroxyphenyl)lactic acid
p-Hydroxyphenyl lactic acid
biggM:M_34hpl
chebi:1117
chebi:11726
chebi:1430
chebi:18660
chebi:19598
chebi:19600
chebi:19932
chebi:28403
chebi:319
hmdb:HMDB00755
keggC:M_C03672
keggC:M_C03964
seedM:M_cpd02305
seedM:M_cpd02461
secondary/obsolete/fantasy identifier
chebi:16003 (R)-3-(4-hydroxyphenyl)lactic acid
(2R)-2-hydroxy-3-(4-hydroxyphenyl)propanoic acid
chebi:10980 (2R)-2-hydroxy-3-(4-hydroxyphenyl)propanoate
(R)-3-(4-Hydroxyphenyl)lactate
(R)-3-(4-hydroxyphenyl)lactate
sabiorkM:6782 3-(4-Hydroxyphenyl)lactate
4-Hydroxyphenyllactate
p-Hydroxyphenyllactate
seedM:cpd02305 HPL
2-Hydroxy-3-(4-hydroxyphenyl)propanoate
3-(4-Hydroxyphenyl)lactate
3-(4-hydroxyphenyl)lactate)
34hpl
4-Hydroxyphenyllactate
4-hydroxyphenyllactate
4-hydroxyphenyllactic acid
p-Hydroxyphenyllactate
p-hydroxyphenyllactate
keggC:C03964 (R)-3-(4-Hydroxyphenyl)lactate
biggM:34hpl 3 4 Hydroxyphenyl lactate
seedM:cpd02461 (R)-3-(4-Hydroxyphenyl)lactate
(R)-3-(4-hydroxyphenyl)lactate
(R+)-3-(4-hydroxyphenyl)lactate
R(+)-4-hydroxyphenyllactate
R(+)-4-hydroxyphenyllactic acid
hmdb:HMDB0000755 Hydroxyphenyllactic acid
(RS)-3-(4-Hydroxyphenyl)lactate
(RS)-3-(4-Hydroxyphenyl)lactic acid
2-Hydroxy-3-(4-hydroxyphenyl)propanoate
2-Hydroxy-3-(4-hydroxyphenyl)propanoic acid
2-Hydroxy-3-(P-hydroxyphenyl)propionate
2-Hydroxy-3-(P-hydroxyphenyl)propionic acid
2-hydroxy-3-(4-hydroxyphenyl)propanoic acid
3-(4-Hydroxyphenyl)-DL-lactate
3-(4-Hydroxyphenyl)-DL-lactic acid
3-(4-Hydroxyphenyl)lactate
3-(4-Hydroxyphenyl)lactic acid
3-(P-Hydroxyphenyl)-lactate
3-(P-Hydroxyphenyl)-lactic acid
4-Hydroxyphenyllactate
4-Hydroxyphenyllactic acid
4-Hydroxyphenyllactic acid, (DL)-isomer
DL-3-(4-Hydroxyphenyl)lactate
DL-3-(4-Hydroxyphenyl)lactic acid
DL-P-Hydroxyphenyllactate
DL-P-Hydroxyphenyllactic acid
HPLA
Hydroxyphenyllactate
P-Hydroxyphenyl lactate
P-Hydroxyphenyl lactic acid
P-Hydroxyphenyllactate
Para-hydroxyphenyllactic acid
a,4-Dihydroxybenzenepropanoate
a,4-Dihydroxybenzenepropanoic acid
b-(4-Hydroxyphenyl)lactate
b-(4-Hydroxyphenyl)lactic acid
b-(P-Hydroxyphenyl)-DL-lactate
b-(P-Hydroxyphenyl)-DL-lactic acid
b-(P-Hydroxyphenyl)lactate
b-(P-Hydroxyphenyl)lactic acid
beta-(4-Hydroxyphenyl)lactate
beta-(4-Hydroxyphenyl)lactic acid
beta-(4-hydroxyphenyl)lactate
beta-(4-hydroxyphenyl)lactic acid
beta-(P-Hydroxyphenyl)-DL-lactate
beta-(P-Hydroxyphenyl)-DL-lactic acid
beta-(P-Hydroxyphenyl)lactate
beta-(P-Hydroxyphenyl)lactic acid
beta-(P-hydroxyphenyl)lactate
beta-(P-hydroxyphenyl)lactic acid
hydroxyphenyllactic acid
MNXM114141is deprecated and replaced by this entry
MNXM527270is deprecated and replaced by MNXM114141